C14H22BrNS — CID 114284878
1-(3-bromophenyl)sulfanyl-3,5-dimethylhexan-2-amine (PubChem CID 114284878) has the molecular formula C14H22BrNS and a molecular weight of 316.31 g/mol. Its IUPAC name is 1-(3-bromophenyl)sulfanyl-3,5-dimethylhexan-2-amine.
| Compound Name | 1-(3-bromophenyl)sulfanyl-3,5-dimethylhexan-2-amine |
|---|---|
| PubChem CID | 114284878 |
| Molecular Formula | C14H22BrNS |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 1-(3-bromophenyl)sulfanyl-3,5-dimethylhexan-2-amine |
| SMILES | CC(C)CC(C)C(N)CSc1cccc(Br)c1 |
| InChI | InChI=1S/C14H22BrNS/c1-10(2)7-11(3)14(16)9-17-13-6-4-5-12(15)8-13/h4-6,8,10-11,14H,7,9,16H2,1-3H3 |
| InChIKey | JXGWDCWHYKZKEJ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |