C17H20BrNS — CID 66160000
1-(3-bromophenyl)sulfanyl-3-(3,4-dimethylphenyl)propan-2-amine (PubChem CID 66160000) has the molecular formula C17H20BrNS and a molecular weight of 350.33 g/mol. Its IUPAC name is 1-(3-bromophenyl)sulfanyl-3-(3,4-dimethylphenyl)propan-2-amine.
| Compound Name | 1-(3-bromophenyl)sulfanyl-3-(3,4-dimethylphenyl)propan-2-amine |
|---|---|
| PubChem CID | 66160000 |
| Molecular Formula | C17H20BrNS |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | 1-(3-bromophenyl)sulfanyl-3-(3,4-dimethylphenyl)propan-2-amine |
| SMILES | Cc1ccc(CC(N)CSc2cccc(Br)c2)cc1C |
| InChI | InChI=1S/C17H20BrNS/c1-12-6-7-14(8-13(12)2)9-16(19)11-20-17-5-3-4-15(18)10-17/h3-8,10,16H,9,11,19H2,1-2H3 |
| InChIKey | LUBAFBKMKWQXKY-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |