C13H14BrNS2 — CID 66159414
1-(3-bromophenyl)sulfanyl-3-thiophen-3-ylpropan-2-amine (PubChem CID 66159414) has the molecular formula C13H14BrNS2 and a molecular weight of 328.30 g/mol. Its IUPAC name is 1-(3-bromophenyl)sulfanyl-3-thiophen-3-ylpropan-2-amine.
| Compound Name | 1-(3-bromophenyl)sulfanyl-3-thiophen-3-ylpropan-2-amine |
|---|---|
| PubChem CID | 66159414 |
| Molecular Formula | C13H14BrNS2 |
| Molecular Weight | 328.30 g/mol |
| Exact Mass | 326.98 |
| IUPAC Name | 1-(3-bromophenyl)sulfanyl-3-thiophen-3-ylpropan-2-amine |
| SMILES | NC(CSc1cccc(Br)c1)Cc1ccsc1 |
| InChI | InChI=1S/C13H14BrNS2/c14-11-2-1-3-13(7-11)17-9-12(15)6-10-4-5-16-8-10/h1-5,7-8,12H,6,9,15H2 |
| InChIKey | SYCZXTADNOKWLF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.30 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |