C13H14FNS2 — CID 66051534
1-(2-fluorophenyl)sulfanyl-3-thiophen-3-ylpropan-2-amine (PubChem CID 66051534) has the molecular formula C13H14FNS2 and a molecular weight of 267.39 g/mol. Its IUPAC name is 1-(2-fluorophenyl)sulfanyl-3-thiophen-3-ylpropan-2-amine.
| Compound Name | 1-(2-fluorophenyl)sulfanyl-3-thiophen-3-ylpropan-2-amine |
|---|---|
| PubChem CID | 66051534 |
| Molecular Formula | C13H14FNS2 |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 1-(2-fluorophenyl)sulfanyl-3-thiophen-3-ylpropan-2-amine |
| SMILES | NC(CSc1ccccc1F)Cc1ccsc1 |
| InChI | InChI=1S/C13H14FNS2/c14-12-3-1-2-4-13(12)17-9-11(15)7-10-5-6-16-8-10/h1-6,8,11H,7,9,15H2 |
| InChIKey | YEKNLZNTOCJOMF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |