4-[(3-bromo-4-methylbenzoyl)amino]-2,2-dimethylbutanoic acid

C14H18BrNO3 — CID 114285495

IUPAC4-[(3-bromo-4-methylbenzoyl)amino]-2,2-dimethylbutanoic acid
SMILESCc1ccc(C(=O)NCCC(C)(C)C(=O)O)cc1Br
InChIInChI=1S/C14H18BrNO3/c1-9-4-5-10(8-11(9)15)12(17)16-7-6-14(2,3)13(18)19/h4-5,8H,6-7H2,1-3H3,(H,16,17)(H,18,19)
InChIKeyPATHUULMSPHJSJ-UHFFFAOYSA-N
MW328.21 g/mol
LogP2.99
Rot. Bonds5

About 4-[(3-bromo-4-methylbenzoyl)amino]-2,2-dimethylbutanoic acid

4-[(3-bromo-4-methylbenzoyl)amino]-2,2-dimethylbutanoic acid (PubChem CID 114285495) has the molecular formula C14H18BrNO3 and a molecular weight of 328.21 g/mol. Its IUPAC name is 4-[(3-bromo-4-methylbenzoyl)amino]-2,2-dimethylbutanoic acid.

Molecular Properties

Compound Name4-[(3-bromo-4-methylbenzoyl)amino]-2,2-dimethylbutanoic acid
PubChem CID114285495
Molecular FormulaC14H18BrNO3
Molecular Weight328.21 g/mol
Exact Mass327.05
IUPAC Name4-[(3-bromo-4-methylbenzoyl)amino]-2,2-dimethylbutanoic acid
SMILESCc1ccc(C(=O)NCCC(C)(C)C(=O)O)cc1Br
InChIInChI=1S/C14H18BrNO3/c1-9-4-5-10(8-11(9)15)12(17)16-7-6-14(2,3)13(18)19/h4-5,8H,6-7H2,1-3H3,(H,16,17)(H,18,19)
InChIKeyPATHUULMSPHJSJ-UHFFFAOYSA-N
XLogP2.99
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500328.21
LogP ≤ 52.99
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 4-[(3-bromo-4-methylbenzoyl)amino]-2,2-dimethylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(3-bromo-4-methylbenzoyl)amino]-2,2-dimethylbutanoic acid?
The IUPAC name of 4-[(3-bromo-4-methylbenzoyl)amino]-2,2-dimethylbutanoic acid (CID 114285495) is 4-[(3-bromo-4-methylbenzoyl)amino]-2,2-dimethylbutanoic acid.
What is the SMILES notation for 4-[(3-bromo-4-methylbenzoyl)amino]-2,2-dimethylbutanoic acid?
The canonical SMILES for 4-[(3-bromo-4-methylbenzoyl)amino]-2,2-dimethylbutanoic acid is Cc1ccc(C(=O)NCCC(C)(C)C(=O)O)cc1Br.
What is the InChIKey of 4-[(3-bromo-4-methylbenzoyl)amino]-2,2-dimethylbutanoic acid?
The InChIKey is PATHUULMSPHJSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18BrNO3/c1-9-4-5-10(8-11(9)15)12(17)16-7-6-14(2,3)13(18)19/h4-5,8H,6-7H2,1-3H3,(H,16,17)(H,18,19).
What are the key properties of 4-[(3-bromo-4-methylbenzoyl)amino]-2,2-dimethylbutanoic acid?
4-[(3-bromo-4-methylbenzoyl)amino]-2,2-dimethylbutanoic acid has a molecular weight of 328.21 g/mol, XLogP of 2.99, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3-bromo-4-methylbenzoyl)amino]-2,2-dimethylbutanoic acid is sourced from PubChem (CID 114285495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).