C15H20BrNO3 — CID 81362189
3-[(3-bromo-4-methylbenzoyl)amino]-2,2,3-trimethylbutanoic acid (PubChem CID 81362189) has the molecular formula C15H20BrNO3 and a molecular weight of 342.23 g/mol. Its IUPAC name is 3-[(3-bromo-4-methylbenzoyl)amino]-2,2,3-trimethylbutanoic acid.
| Compound Name | 3-[(3-bromo-4-methylbenzoyl)amino]-2,2,3-trimethylbutanoic acid |
|---|---|
| PubChem CID | 81362189 |
| Molecular Formula | C15H20BrNO3 |
| Molecular Weight | 342.23 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | 3-[(3-bromo-4-methylbenzoyl)amino]-2,2,3-trimethylbutanoic acid |
| SMILES | Cc1ccc(C(=O)NC(C)(C)C(C)(C)C(=O)O)cc1Br |
| InChI | InChI=1S/C15H20BrNO3/c1-9-6-7-10(8-11(9)16)12(18)17-15(4,5)14(2,3)13(19)20/h6-8H,1-5H3,(H,17,18)(H,19,20) |
| InChIKey | GBSGJEZMHXPWIG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.23 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |