C10H9ClN6S — CID 114286106
7-chloro-1-[2-(triazol-1-yl)ethyl]-3H-imidazo[4,5-c]pyridine-2-thione (PubChem CID 114286106) has the molecular formula C10H9ClN6S and a molecular weight of 280.74 g/mol. Its IUPAC name is 7-chloro-1-[2-(triazol-1-yl)ethyl]-3H-imidazo[4,5-c]pyridine-2-thione.
| Compound Name | 7-chloro-1-[2-(triazol-1-yl)ethyl]-3H-imidazo[4,5-c]pyridine-2-thione |
|---|---|
| PubChem CID | 114286106 |
| Molecular Formula | C10H9ClN6S |
| Molecular Weight | 280.74 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 7-chloro-1-[2-(triazol-1-yl)ethyl]-3H-imidazo[4,5-c]pyridine-2-thione |
| SMILES | S=c1[nH]c2cncc(Cl)c2n1CCn1ccnn1 |
| InChI | InChI=1S/C10H9ClN6S/c11-7-5-12-6-8-9(7)17(10(18)14-8)4-3-16-2-1-13-15-16/h1-2,5-6H,3-4H2,(H,14,18) |
| InChIKey | RQZXQBYJCSHJHO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 64.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.74 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|