C11H10Cl2N6 — CID 113413048
6-chloro-2-(chloromethyl)-3-[2-(triazol-1-yl)ethyl]imidazo[4,5-b]pyridine (PubChem CID 113413048) has the molecular formula C11H10Cl2N6 and a molecular weight of 297.15 g/mol. Its IUPAC name is 6-chloro-2-(chloromethyl)-3-[2-(triazol-1-yl)ethyl]imidazo[4,5-b]pyridine.
| Compound Name | 6-chloro-2-(chloromethyl)-3-[2-(triazol-1-yl)ethyl]imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 113413048 |
| Molecular Formula | C11H10Cl2N6 |
| Molecular Weight | 297.15 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | 6-chloro-2-(chloromethyl)-3-[2-(triazol-1-yl)ethyl]imidazo[4,5-b]pyridine |
| SMILES | ClCc1nc2cc(Cl)cnc2n1CCn1ccnn1 |
| InChI | InChI=1S/C11H10Cl2N6/c12-6-10-16-9-5-8(13)7-14-11(9)19(10)4-3-18-2-1-15-17-18/h1-2,5,7H,3-4,6H2 |
| InChIKey | ZPSCDVPPHFKESY-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.15 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|