C9H10Cl2N4 — CID 83018919
6-chloro-2-(chloromethyl)-N,N-dimethylimidazo[4,5-b]pyridin-3-amine (PubChem CID 83018919) has the molecular formula C9H10Cl2N4 and a molecular weight of 245.11 g/mol. Its IUPAC name is 6-chloro-2-(chloromethyl)-N,N-dimethylimidazo[4,5-b]pyridin-3-amine.
| Compound Name | 6-chloro-2-(chloromethyl)-N,N-dimethylimidazo[4,5-b]pyridin-3-amine |
|---|---|
| PubChem CID | 83018919 |
| Molecular Formula | C9H10Cl2N4 |
| Molecular Weight | 245.11 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 6-chloro-2-(chloromethyl)-N,N-dimethylimidazo[4,5-b]pyridin-3-amine |
| SMILES | CN(C)n1c(CCl)nc2cc(Cl)cnc21 |
| InChI | InChI=1S/C9H10Cl2N4/c1-14(2)15-8(4-10)13-7-3-6(11)5-12-9(7)15/h3,5H,4H2,1-2H3 |
| InChIKey | KAIGHGUMJBUZBR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.11 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|