C13H6BrCl4N3 — CID 107791834
3-(4-bromo-2,3-dichlorophenyl)-6-chloro-2-(chloromethyl)imidazo[4,5-b]pyridine (PubChem CID 107791834) has the molecular formula C13H6BrCl4N3 and a molecular weight of 425.93 g/mol. Its IUPAC name is 3-(4-bromo-2,3-dichlorophenyl)-6-chloro-2-(chloromethyl)imidazo[4,5-b]pyridine.
| Compound Name | 3-(4-bromo-2,3-dichlorophenyl)-6-chloro-2-(chloromethyl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 107791834 |
| Molecular Formula | C13H6BrCl4N3 |
| Molecular Weight | 425.93 g/mol |
| Exact Mass | 422.85 |
| IUPAC Name | 3-(4-bromo-2,3-dichlorophenyl)-6-chloro-2-(chloromethyl)imidazo[4,5-b]pyridine |
| SMILES | ClCc1nc2cc(Cl)cnc2n1-c1ccc(Br)c(Cl)c1Cl |
| InChI | InChI=1S/C13H6BrCl4N3/c14-7-1-2-9(12(18)11(7)17)21-10(4-15)20-8-3-6(16)5-19-13(8)21/h1-3,5H,4H2 |
| InChIKey | CXLWPQYDPRZQGD-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.93 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|