C12H11Cl2N5 — CID 114286238
7-chloro-2-(2-chloroethyl)-1-(1-methylpyrazol-4-yl)imidazo[4,5-c]pyridine (PubChem CID 114286238) has the molecular formula C12H11Cl2N5 and a molecular weight of 296.16 g/mol. Its IUPAC name is 7-chloro-2-(2-chloroethyl)-1-(1-methylpyrazol-4-yl)imidazo[4,5-c]pyridine.
| Compound Name | 7-chloro-2-(2-chloroethyl)-1-(1-methylpyrazol-4-yl)imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 114286238 |
| Molecular Formula | C12H11Cl2N5 |
| Molecular Weight | 296.16 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 7-chloro-2-(2-chloroethyl)-1-(1-methylpyrazol-4-yl)imidazo[4,5-c]pyridine |
| SMILES | Cn1cc(-n2c(CCCl)nc3cncc(Cl)c32)cn1 |
| InChI | InChI=1S/C12H11Cl2N5/c1-18-7-8(4-16-18)19-11(2-3-13)17-10-6-15-5-9(14)12(10)19/h4-7H,2-3H2,1H3 |
| InChIKey | UOZXMMUGTZOSPL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.16 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|