C17H22N2O2 — CID 114286917
N-[1,4-dioxan-2-yl(quinolin-7-yl)methyl]propan-1-amine (PubChem CID 114286917) has the molecular formula C17H22N2O2 and a molecular weight of 286.37 g/mol. Its IUPAC name is N-[1,4-dioxan-2-yl(quinolin-7-yl)methyl]propan-1-amine.
| Compound Name | N-[1,4-dioxan-2-yl(quinolin-7-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 114286917 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | N-[1,4-dioxan-2-yl(quinolin-7-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1ccc2cccnc2c1)C1COCCO1 |
| InChI | InChI=1S/C17H22N2O2/c1-2-7-19-17(16-12-20-9-10-21-16)14-6-5-13-4-3-8-18-15(13)11-14/h3-6,8,11,16-17,19H,2,7,9-10,12H2,1H3 |
| InChIKey | XMBYEMLXFHEAIA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |