C14H18BrNO — CID 114287306
6-bromo-4,4-dimethyl-1,2,3,4a,10,10a-hexahydrophenoxazine (PubChem CID 114287306) has the molecular formula C14H18BrNO and a molecular weight of 296.21 g/mol. Its IUPAC name is 6-bromo-4,4-dimethyl-1,2,3,4a,10,10a-hexahydrophenoxazine.
| Compound Name | 6-bromo-4,4-dimethyl-1,2,3,4a,10,10a-hexahydrophenoxazine |
|---|---|
| PubChem CID | 114287306 |
| Molecular Formula | C14H18BrNO |
| Molecular Weight | 296.21 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 6-bromo-4,4-dimethyl-1,2,3,4a,10,10a-hexahydrophenoxazine |
| SMILES | CC1(C)CCCC2Nc3cccc(Br)c3OC21 |
| InChI | InChI=1S/C14H18BrNO/c1-14(2)8-4-7-11-13(14)17-12-9(15)5-3-6-10(12)16-11/h3,5-6,11,13,16H,4,7-8H2,1-2H3 |
| InChIKey | RAMTYXASSJQWJX-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.21 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |