C12H9Cl2N3S — CID 114288050
3-(2,4-dichloroanilino)pyridine-4-carbothioamide (PubChem CID 114288050) has the molecular formula C12H9Cl2N3S and a molecular weight of 298.20 g/mol. Its IUPAC name is 3-(2,4-dichloroanilino)pyridine-4-carbothioamide.
| Compound Name | 3-(2,4-dichloroanilino)pyridine-4-carbothioamide |
|---|---|
| PubChem CID | 114288050 |
| Molecular Formula | C12H9Cl2N3S |
| Molecular Weight | 298.20 g/mol |
| Exact Mass | 296.99 |
| IUPAC Name | 3-(2,4-dichloroanilino)pyridine-4-carbothioamide |
| SMILES | NC(=S)c1ccncc1Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H9Cl2N3S/c13-7-1-2-10(9(14)5-7)17-11-6-16-4-3-8(11)12(15)18/h1-6,17H,(H2,15,18) |
| InChIKey | RAVNXOJJXVESGO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.20 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|