C12H8ClF2N3S — CID 83087296
3-(2-chloro-4,6-difluoroanilino)pyridine-4-carbothioamide (PubChem CID 83087296) has the molecular formula C12H8ClF2N3S and a molecular weight of 299.73 g/mol. Its IUPAC name is 3-(2-chloro-4,6-difluoroanilino)pyridine-4-carbothioamide.
| Compound Name | 3-(2-chloro-4,6-difluoroanilino)pyridine-4-carbothioamide |
|---|---|
| PubChem CID | 83087296 |
| Molecular Formula | C12H8ClF2N3S |
| Molecular Weight | 299.73 g/mol |
| Exact Mass | 299.01 |
| IUPAC Name | 3-(2-chloro-4,6-difluoroanilino)pyridine-4-carbothioamide |
| SMILES | NC(=S)c1ccncc1Nc1c(F)cc(F)cc1Cl |
| InChI | InChI=1S/C12H8ClF2N3S/c13-8-3-6(14)4-9(15)11(8)18-10-5-17-2-1-7(10)12(16)19/h1-5,18H,(H2,16,19) |
| InChIKey | GCZSPTBGJPDHQI-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.73 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|