C13H18N4OS — CID 114288364
1-(4-carbamothioyl-3-pyridinyl)-6-methylpiperidine-3-carboxamide (PubChem CID 114288364) has the molecular formula C13H18N4OS and a molecular weight of 278.38 g/mol. Its IUPAC name is 1-(4-carbamothioyl-3-pyridinyl)-6-methylpiperidine-3-carboxamide.
| Compound Name | 1-(4-carbamothioyl-3-pyridinyl)-6-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 114288364 |
| Molecular Formula | C13H18N4OS |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 1-(4-carbamothioyl-3-pyridinyl)-6-methylpiperidine-3-carboxamide |
| SMILES | CC1CCC(C(N)=O)CN1c1cnccc1C(N)=S |
| InChI | InChI=1S/C13H18N4OS/c1-8-2-3-9(12(14)18)7-17(8)11-6-16-5-4-10(11)13(15)19/h4-6,8-9H,2-3,7H2,1H3,(H2,14,18)(H2,15,19) |
| InChIKey | NNOPGIBUKVHWKH-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|