About 1,2-Butanediol
1,2-Butanediol (PubChem CID 11429) has the molecular formula C4H10O2
and a molecular weight of 90.12 g/mol. Its IUPAC name is butane-1,2-diol.
Molecular Properties
| Compound Name | 1,2-Butanediol |
| PubChem CID | 11429 |
| Molecular Formula | C4H10O2 |
| Molecular Weight | 90.12 g/mol |
| Exact Mass | 90.07 |
| IUPAC Name | butane-1,2-diol |
| SMILES | CCC(CO)O |
| InChI | InChI=1S/C4H10O2/c1-2-4(6)3-5/h4-6H,2-3H2,1H3 |
| InChIKey | BMRWNKZVCUKKSR-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 40.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | 28 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 90.12 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,2-Butanediol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-Butanediol?
The IUPAC name of 1,2-Butanediol (CID 11429) is butane-1,2-diol.
What is the SMILES notation for 1,2-Butanediol?
The canonical SMILES for 1,2-Butanediol is CCC(CO)O.
What is the InChIKey of 1,2-Butanediol?
The InChIKey is BMRWNKZVCUKKSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O2/c1-2-4(6)3-5/h4-6H,2-3H2,1H3.
What are the key properties of 1,2-Butanediol?
1,2-Butanediol has a molecular weight of 90.12 g/mol, XLogP of -0.20, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-Butanediol is sourced from PubChem (CID 11429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).