C10H13BrN4OS — CID 114292383
N-(5-bromopyrazin-2-yl)-2-carbamothioyl-2-methylbutanamide (PubChem CID 114292383) has the molecular formula C10H13BrN4OS and a molecular weight of 317.21 g/mol. Its IUPAC name is N-(5-bromopyrazin-2-yl)-2-carbamothioyl-2-methylbutanamide.
| Compound Name | N-(5-bromopyrazin-2-yl)-2-carbamothioyl-2-methylbutanamide |
|---|---|
| PubChem CID | 114292383 |
| Molecular Formula | C10H13BrN4OS |
| Molecular Weight | 317.21 g/mol |
| Exact Mass | 316.00 |
| IUPAC Name | N-(5-bromopyrazin-2-yl)-2-carbamothioyl-2-methylbutanamide |
| SMILES | CCC(C)(C(=O)Nc1cnc(Br)cn1)C(N)=S |
| InChI | InChI=1S/C10H13BrN4OS/c1-3-10(2,8(12)17)9(16)15-7-5-13-6(11)4-14-7/h4-5H,3H2,1-2H3,(H2,12,17)(H,14,15,16) |
| InChIKey | ZVTRTMGHIMJXGW-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.21 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|