C12H18N4O2S — CID 107600478
2-carbamothioyl-N-(4-methoxy-6-methylpyrimidin-2-yl)-2-methylbutanamide (PubChem CID 107600478) has the molecular formula C12H18N4O2S and a molecular weight of 282.37 g/mol. Its IUPAC name is 2-carbamothioyl-N-(4-methoxy-6-methylpyrimidin-2-yl)-2-methylbutanamide.
| Compound Name | 2-carbamothioyl-N-(4-methoxy-6-methylpyrimidin-2-yl)-2-methylbutanamide |
|---|---|
| PubChem CID | 107600478 |
| Molecular Formula | C12H18N4O2S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 2-carbamothioyl-N-(4-methoxy-6-methylpyrimidin-2-yl)-2-methylbutanamide |
| SMILES | CCC(C)(C(=O)Nc1nc(C)cc(OC)n1)C(N)=S |
| InChI | InChI=1S/C12H18N4O2S/c1-5-12(3,9(13)19)10(17)16-11-14-7(2)6-8(15-11)18-4/h6H,5H2,1-4H3,(H2,13,19)(H,14,15,16,17) |
| InChIKey | AGVADTZANFBLJS-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|