C10H16N4O3S2 — CID 107600498
2-[(4-methoxy-6-methylpyrimidin-2-yl)sulfamoyl]butanethioamide (PubChem CID 107600498) has the molecular formula C10H16N4O3S2 and a molecular weight of 304.40 g/mol. Its IUPAC name is 2-[(4-methoxy-6-methylpyrimidin-2-yl)sulfamoyl]butanethioamide.
| Compound Name | 2-[(4-methoxy-6-methylpyrimidin-2-yl)sulfamoyl]butanethioamide |
|---|---|
| PubChem CID | 107600498 |
| Molecular Formula | C10H16N4O3S2 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 2-[(4-methoxy-6-methylpyrimidin-2-yl)sulfamoyl]butanethioamide |
| SMILES | CCC(C(N)=S)S(=O)(=O)Nc1nc(C)cc(OC)n1 |
| InChI | InChI=1S/C10H16N4O3S2/c1-4-7(9(11)18)19(15,16)14-10-12-6(2)5-8(13-10)17-3/h5,7H,4H2,1-3H3,(H2,11,18)(H,12,13,14) |
| InChIKey | GPRZAPPTNTXIRB-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|