C8H11N3OS2 — CID 117062845
methyl N-(4-methoxy-6-methylpyrimidin-2-yl)carbamodithioate (PubChem CID 117062845) has the molecular formula C8H11N3OS2 and a molecular weight of 229.33 g/mol. Its IUPAC name is methyl N-(4-methoxy-6-methylpyrimidin-2-yl)carbamodithioate.
| Compound Name | methyl N-(4-methoxy-6-methylpyrimidin-2-yl)carbamodithioate |
|---|---|
| PubChem CID | 117062845 |
| Molecular Formula | C8H11N3OS2 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | methyl N-(4-methoxy-6-methylpyrimidin-2-yl)carbamodithioate |
| SMILES | COc1cc(C)nc(NC(=S)SC)n1 |
| InChI | InChI=1S/C8H11N3OS2/c1-5-4-6(12-2)10-7(9-5)11-8(13)14-3/h4H,1-3H3,(H,9,10,11,13) |
| InChIKey | VAIFFLXCWPWNJX-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|