C10H20N4O3 — CID 114292643
2-(N'-hydroxycarbamimidoyl)-N,2-dimethyl-N-[2-(methylamino)-2-oxoethyl]butanamide (PubChem CID 114292643) has the molecular formula C10H20N4O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is 2-(N'-hydroxycarbamimidoyl)-N,2-dimethyl-N-[2-(methylamino)-2-oxoethyl]butanamide.
| Compound Name | 2-(N'-hydroxycarbamimidoyl)-N,2-dimethyl-N-[2-(methylamino)-2-oxoethyl]butanamide |
|---|---|
| PubChem CID | 114292643 |
| Molecular Formula | C10H20N4O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | 2-(N'-hydroxycarbamimidoyl)-N,2-dimethyl-N-[2-(methylamino)-2-oxoethyl]butanamide |
| SMILES | CCC(C)(C(=O)N(C)CC(=O)NC)C(N)=NO |
| InChI | InChI=1S/C10H20N4O3/c1-5-10(2,8(11)13-17)9(16)14(4)6-7(15)12-3/h17H,5-6H2,1-4H3,(H2,11,13)(H,12,15) |
| InChIKey | SQAUJSSFYCFVKR-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 108.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|