About 2-(N'-hydroxycarbamimidoyl)-N,2-dimethyl-N-(3-methylbutan-2-yl)butanamide
2-(N'-hydroxycarbamimidoyl)-N,2-dimethyl-N-(3-methylbutan-2-yl)butanamide (PubChem CID 113270772) has the molecular formula C12H25N3O2
and a molecular weight of 243.35 g/mol. Its IUPAC name is 2-(N'-hydroxycarbamimidoyl)-N,2-dimethyl-N-(3-methylbutan-2-yl)butanamide.
Molecular Properties
| Compound Name | 2-(N'-hydroxycarbamimidoyl)-N,2-dimethyl-N-(3-methylbutan-2-yl)butanamide |
| PubChem CID | 113270772 |
| Molecular Formula | C12H25N3O2 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.19 |
| IUPAC Name | 2-(N'-hydroxycarbamimidoyl)-N,2-dimethyl-N-(3-methylbutan-2-yl)butanamide |
| SMILES | CCC(C)(C(=O)N(C)C(C)C(C)C)C(N)=NO |
| InChI | InChI=1S/C12H25N3O2/c1-7-12(5,10(13)14-17)11(16)15(6)9(4)8(2)3/h8-9,17H,7H2,1-6H3,(H2,13,14) |
| InChIKey | HOGSBRCKGOCEOQ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(N'-hydroxycarbamimidoyl)-N,2-dimethyl-N-(3-methylbutan-2-yl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(N'-hydroxycarbamimidoyl)-N,2-dimethyl-N-(3-methylbutan-2-yl)butanamide?
The IUPAC name of 2-(N'-hydroxycarbamimidoyl)-N,2-dimethyl-N-(3-methylbutan-2-yl)butanamide (CID 113270772) is 2-(N'-hydroxycarbamimidoyl)-N,2-dimethyl-N-(3-methylbutan-2-yl)butanamide.
What is the SMILES notation for 2-(N'-hydroxycarbamimidoyl)-N,2-dimethyl-N-(3-methylbutan-2-yl)butanamide?
The canonical SMILES for 2-(N'-hydroxycarbamimidoyl)-N,2-dimethyl-N-(3-methylbutan-2-yl)butanamide is CCC(C)(C(=O)N(C)C(C)C(C)C)C(N)=NO.
What is the InChIKey of 2-(N'-hydroxycarbamimidoyl)-N,2-dimethyl-N-(3-methylbutan-2-yl)butanamide?
The InChIKey is HOGSBRCKGOCEOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25N3O2/c1-7-12(5,10(13)14-17)11(16)15(6)9(4)8(2)3/h8-9,17H,7H2,1-6H3,(H2,13,14).
What are the key properties of 2-(N'-hydroxycarbamimidoyl)-N,2-dimethyl-N-(3-methylbutan-2-yl)butanamide?
2-(N'-hydroxycarbamimidoyl)-N,2-dimethyl-N-(3-methylbutan-2-yl)butanamide has a molecular weight of 243.35 g/mol, XLogP of 1.65, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(N'-hydroxycarbamimidoyl)-N,2-dimethyl-N-(3-methylbutan-2-yl)butanamide is sourced from PubChem (CID 113270772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).