C9H18BrNO2S — CID 114293976
N-[1-(bromomethyl)-4-methylcyclohexyl]methanesulfonamide (PubChem CID 114293976) has the molecular formula C9H18BrNO2S and a molecular weight of 284.22 g/mol. Its IUPAC name is N-[1-(bromomethyl)-4-methylcyclohexyl]methanesulfonamide.
| Compound Name | N-[1-(bromomethyl)-4-methylcyclohexyl]methanesulfonamide |
|---|---|
| PubChem CID | 114293976 |
| Molecular Formula | C9H18BrNO2S |
| Molecular Weight | 284.22 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | N-[1-(bromomethyl)-4-methylcyclohexyl]methanesulfonamide |
| SMILES | CC1CCC(CBr)(NS(C)(=O)=O)CC1 |
| InChI | InChI=1S/C9H18BrNO2S/c1-8-3-5-9(7-10,6-4-8)11-14(2,12)13/h8,11H,3-7H2,1-2H3 |
| InChIKey | RAGWVHBMBBYAHU-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.22 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|