C6H12BrF2NO2S — CID 114294740
N-(1-bromo-3-methylbutan-2-yl)-1,1-difluoromethanesulfonamide (PubChem CID 114294740) has the molecular formula C6H12BrF2NO2S and a molecular weight of 280.13 g/mol. Its IUPAC name is N-(1-bromo-3-methylbutan-2-yl)-1,1-difluoromethanesulfonamide.
| Compound Name | N-(1-bromo-3-methylbutan-2-yl)-1,1-difluoromethanesulfonamide |
|---|---|
| PubChem CID | 114294740 |
| Molecular Formula | C6H12BrF2NO2S |
| Molecular Weight | 280.13 g/mol |
| Exact Mass | 278.97 |
| IUPAC Name | N-(1-bromo-3-methylbutan-2-yl)-1,1-difluoromethanesulfonamide |
| SMILES | CC(C)C(CBr)NS(=O)(=O)C(F)F |
| InChI | InChI=1S/C6H12BrF2NO2S/c1-4(2)5(3-7)10-13(11,12)6(8)9/h4-6,10H,3H2,1-2H3 |
| InChIKey | GNZZYXSIJDPPEA-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.13 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|