C10H12Cl2N2O — CID 114295004
5-chloro-N-(1-chloro-2-methylpropan-2-yl)pyridine-2-carboxamide (PubChem CID 114295004) has the molecular formula C10H12Cl2N2O and a molecular weight of 247.12 g/mol. Its IUPAC name is 5-chloro-N-(1-chloro-2-methylpropan-2-yl)pyridine-2-carboxamide.
| Compound Name | 5-chloro-N-(1-chloro-2-methylpropan-2-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 114295004 |
| Molecular Formula | C10H12Cl2N2O |
| Molecular Weight | 247.12 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | 5-chloro-N-(1-chloro-2-methylpropan-2-yl)pyridine-2-carboxamide |
| SMILES | CC(C)(CCl)NC(=O)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C10H12Cl2N2O/c1-10(2,6-11)14-9(15)8-4-3-7(12)5-13-8/h3-5H,6H2,1-2H3,(H,14,15) |
| InChIKey | WUHIETGEXSYTBT-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.12 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|