C12H14ClF2NO — CID 82816226
N-(1-chloro-2-methylpropan-2-yl)-2,6-difluoro-3-methylbenzamide (PubChem CID 82816226) has the molecular formula C12H14ClF2NO and a molecular weight of 261.70 g/mol. Its IUPAC name is N-(1-chloro-2-methylpropan-2-yl)-2,6-difluoro-3-methylbenzamide.
| Compound Name | N-(1-chloro-2-methylpropan-2-yl)-2,6-difluoro-3-methylbenzamide |
|---|---|
| PubChem CID | 82816226 |
| Molecular Formula | C12H14ClF2NO |
| Molecular Weight | 261.70 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | N-(1-chloro-2-methylpropan-2-yl)-2,6-difluoro-3-methylbenzamide |
| SMILES | Cc1ccc(F)c(C(=O)NC(C)(C)CCl)c1F |
| InChI | InChI=1S/C12H14ClF2NO/c1-7-4-5-8(14)9(10(7)15)11(17)16-12(2,3)6-13/h4-5H,6H2,1-3H3,(H,16,17) |
| InChIKey | JNOVDWFLRSPEHS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.70 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|