C18H31NSi — CID 11430220
(2-methyl-2,3-dihydroindol-1-yl)-tri(propan-2-yl)silane (PubChem CID 11430220) has the molecular formula C18H31NSi and a molecular weight of 289.54 g/mol. Its IUPAC name is (2-methyl-2,3-dihydroindol-1-yl)-tri(propan-2-yl)silane.
| Compound Name | (2-methyl-2,3-dihydroindol-1-yl)-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 11430220 |
| Molecular Formula | C18H31NSi |
| Molecular Weight | 289.54 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | (2-methyl-2,3-dihydroindol-1-yl)-tri(propan-2-yl)silane |
| SMILES | CC1Cc2ccccc2N1[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C18H31NSi/c1-13(2)20(14(3)4,15(5)6)19-16(7)12-17-10-8-9-11-18(17)19/h8-11,13-16H,12H2,1-7H3 |
| InChIKey | OGYFRUPQEVDFJS-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.54 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|