C27H51NSi2 — CID 11224607
[2-methyl-1-tri(propan-2-yl)silyl-2,3-dihydroindol-4-yl]-tri(propan-2-yl)silane (PubChem CID 11224607) has the molecular formula C27H51NSi2 and a molecular weight of 445.88 g/mol. Its IUPAC name is [2-methyl-1-tri(propan-2-yl)silyl-2,3-dihydroindol-4-yl]-tri(propan-2-yl)silane.
| Compound Name | [2-methyl-1-tri(propan-2-yl)silyl-2,3-dihydroindol-4-yl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 11224607 |
| Molecular Formula | C27H51NSi2 |
| Molecular Weight | 445.88 g/mol |
| Exact Mass | 445.36 |
| IUPAC Name | [2-methyl-1-tri(propan-2-yl)silyl-2,3-dihydroindol-4-yl]-tri(propan-2-yl)silane |
| SMILES | CC1Cc2c(cccc2[Si](C(C)C)(C(C)C)C(C)C)N1[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C27H51NSi2/c1-18(2)29(19(3)4,20(5)6)27-16-14-15-26-25(27)17-24(13)28(26)30(21(7)8,22(9)10)23(11)12/h14-16,18-24H,17H2,1-13H3 |
| InChIKey | YGCWYMPMVCIVQZ-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.88 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|