C14H11ClN2O4 — CID 114302230
N-(2-chloro-2,3-dihydro-1H-inden-1-yl)-5-nitrofuran-2-carboxamide (PubChem CID 114302230) has the molecular formula C14H11ClN2O4 and a molecular weight of 306.71 g/mol. Its IUPAC name is N-(2-chloro-2,3-dihydro-1H-inden-1-yl)-5-nitrofuran-2-carboxamide.
| Compound Name | N-(2-chloro-2,3-dihydro-1H-inden-1-yl)-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 114302230 |
| Molecular Formula | C14H11ClN2O4 |
| Molecular Weight | 306.71 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | N-(2-chloro-2,3-dihydro-1H-inden-1-yl)-5-nitrofuran-2-carboxamide |
| SMILES | O=C(NC1c2ccccc2CC1Cl)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C14H11ClN2O4/c15-10-7-8-3-1-2-4-9(8)13(10)16-14(18)11-5-6-12(21-11)17(19)20/h1-6,10,13H,7H2,(H,16,18) |
| InChIKey | LKQGVYFWVWWCMU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 85.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.71 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|