C14H18ClNO2S — CID 114302988
N-[3-(chloromethyl)-4-ethoxyphenyl]thiolane-2-carboxamide (PubChem CID 114302988) has the molecular formula C14H18ClNO2S and a molecular weight of 299.82 g/mol. Its IUPAC name is N-[3-(chloromethyl)-4-ethoxyphenyl]thiolane-2-carboxamide.
| Compound Name | N-[3-(chloromethyl)-4-ethoxyphenyl]thiolane-2-carboxamide |
|---|---|
| PubChem CID | 114302988 |
| Molecular Formula | C14H18ClNO2S |
| Molecular Weight | 299.82 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | N-[3-(chloromethyl)-4-ethoxyphenyl]thiolane-2-carboxamide |
| SMILES | CCOc1ccc(NC(=O)C2CCCS2)cc1CCl |
| InChI | InChI=1S/C14H18ClNO2S/c1-2-18-12-6-5-11(8-10(12)9-15)16-14(17)13-4-3-7-19-13/h5-6,8,13H,2-4,7,9H2,1H3,(H,16,17) |
| InChIKey | RAIZKBLTYLJKRP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.82 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|