C14H17ClN2O3 — CID 114303186
N-[(2-chlorocyclopentyl)methyl]-2-methyl-3-nitrobenzamide (PubChem CID 114303186) has the molecular formula C14H17ClN2O3 and a molecular weight of 296.75 g/mol. Its IUPAC name is N-[(2-chlorocyclopentyl)methyl]-2-methyl-3-nitrobenzamide.
| Compound Name | N-[(2-chlorocyclopentyl)methyl]-2-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 114303186 |
| Molecular Formula | C14H17ClN2O3 |
| Molecular Weight | 296.75 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | N-[(2-chlorocyclopentyl)methyl]-2-methyl-3-nitrobenzamide |
| SMILES | Cc1c(C(=O)NCC2CCCC2Cl)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H17ClN2O3/c1-9-11(5-3-7-13(9)17(19)20)14(18)16-8-10-4-2-6-12(10)15/h3,5,7,10,12H,2,4,6,8H2,1H3,(H,16,18) |
| InChIKey | RYEOJSJYKPPCCB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.75 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|