C14H17BrN2O3 — CID 114312172
N-[(2-bromocyclohexyl)methyl]-2-nitrobenzamide (PubChem CID 114312172) has the molecular formula C14H17BrN2O3 and a molecular weight of 341.21 g/mol. Its IUPAC name is N-[(2-bromocyclohexyl)methyl]-2-nitrobenzamide.
| Compound Name | N-[(2-bromocyclohexyl)methyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 114312172 |
| Molecular Formula | C14H17BrN2O3 |
| Molecular Weight | 341.21 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | N-[(2-bromocyclohexyl)methyl]-2-nitrobenzamide |
| SMILES | O=C(NCC1CCCCC1Br)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H17BrN2O3/c15-12-7-3-1-5-10(12)9-16-14(18)11-6-2-4-8-13(11)17(19)20/h2,4,6,8,10,12H,1,3,5,7,9H2,(H,16,18) |
| InChIKey | IXPHVNJLEFKFTK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.21 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|