C13H13BrF2N2O3 — CID 114313778
N-[(2-bromocyclopentyl)methyl]-4,5-difluoro-2-nitrobenzamide (PubChem CID 114313778) has the molecular formula C13H13BrF2N2O3 and a molecular weight of 363.16 g/mol. Its IUPAC name is N-[(2-bromocyclopentyl)methyl]-4,5-difluoro-2-nitrobenzamide.
| Compound Name | N-[(2-bromocyclopentyl)methyl]-4,5-difluoro-2-nitrobenzamide |
|---|---|
| PubChem CID | 114313778 |
| Molecular Formula | C13H13BrF2N2O3 |
| Molecular Weight | 363.16 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | N-[(2-bromocyclopentyl)methyl]-4,5-difluoro-2-nitrobenzamide |
| SMILES | O=C(NCC1CCCC1Br)c1cc(F)c(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H13BrF2N2O3/c14-9-3-1-2-7(9)6-17-13(19)8-4-10(15)11(16)5-12(8)18(20)21/h4-5,7,9H,1-3,6H2,(H,17,19) |
| InChIKey | ITCVNXXICCPSFH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.16 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|