C17H22ClNO — CID 114303546
N-[1-(chloromethyl)cyclohexyl]-1-phenylcyclopropane-1-carboxamide (PubChem CID 114303546) has the molecular formula C17H22ClNO and a molecular weight of 291.82 g/mol. Its IUPAC name is N-[1-(chloromethyl)cyclohexyl]-1-phenylcyclopropane-1-carboxamide.
| Compound Name | N-[1-(chloromethyl)cyclohexyl]-1-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 114303546 |
| Molecular Formula | C17H22ClNO |
| Molecular Weight | 291.82 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | N-[1-(chloromethyl)cyclohexyl]-1-phenylcyclopropane-1-carboxamide |
| SMILES | O=C(NC1(CCl)CCCCC1)C1(c2ccccc2)CC1 |
| InChI | InChI=1S/C17H22ClNO/c18-13-16(9-5-2-6-10-16)19-15(20)17(11-12-17)14-7-3-1-4-8-14/h1,3-4,7-8H,2,5-6,9-13H2,(H,19,20) |
| InChIKey | HMPTWDMAFDZJDE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.82 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|