C8H13ClF3NO — CID 114303828
N-(1-chloro-2-methylbutan-2-yl)-3,3,3-trifluoropropanamide (PubChem CID 114303828) has the molecular formula C8H13ClF3NO and a molecular weight of 231.64 g/mol. Its IUPAC name is N-(1-chloro-2-methylbutan-2-yl)-3,3,3-trifluoropropanamide.
| Compound Name | N-(1-chloro-2-methylbutan-2-yl)-3,3,3-trifluoropropanamide |
|---|---|
| PubChem CID | 114303828 |
| Molecular Formula | C8H13ClF3NO |
| Molecular Weight | 231.64 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | N-(1-chloro-2-methylbutan-2-yl)-3,3,3-trifluoropropanamide |
| SMILES | CCC(C)(CCl)NC(=O)CC(F)(F)F |
| InChI | InChI=1S/C8H13ClF3NO/c1-3-7(2,5-9)13-6(14)4-8(10,11)12/h3-5H2,1-2H3,(H,13,14) |
| InChIKey | USHWYVFNUUEIQA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.64 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|