C8H12Br2F3NO — CID 107868085
N-[1-bromo-2-(bromomethyl)butan-2-yl]-3,3,3-trifluoropropanamide (PubChem CID 107868085) has the molecular formula C8H12Br2F3NO and a molecular weight of 354.99 g/mol. Its IUPAC name is N-[1-bromo-2-(bromomethyl)butan-2-yl]-3,3,3-trifluoropropanamide.
| Compound Name | N-[1-bromo-2-(bromomethyl)butan-2-yl]-3,3,3-trifluoropropanamide |
|---|---|
| PubChem CID | 107868085 |
| Molecular Formula | C8H12Br2F3NO |
| Molecular Weight | 354.99 g/mol |
| Exact Mass | 352.92 |
| IUPAC Name | N-[1-bromo-2-(bromomethyl)butan-2-yl]-3,3,3-trifluoropropanamide |
| SMILES | CCC(CBr)(CBr)NC(=O)CC(F)(F)F |
| InChI | InChI=1S/C8H12Br2F3NO/c1-2-7(4-9,5-10)14-6(15)3-8(11,12)13/h2-5H2,1H3,(H,14,15) |
| InChIKey | XDYDHHHNHZYLGL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.99 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|