C16H21Cl2NO — CID 114303953
N-[1-(chloromethyl)-3-methylcyclohexyl]-2-(3-chlorophenyl)acetamide (PubChem CID 114303953) has the molecular formula C16H21Cl2NO and a molecular weight of 314.26 g/mol. Its IUPAC name is N-[1-(chloromethyl)-3-methylcyclohexyl]-2-(3-chlorophenyl)acetamide.
| Compound Name | N-[1-(chloromethyl)-3-methylcyclohexyl]-2-(3-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 114303953 |
| Molecular Formula | C16H21Cl2NO |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | N-[1-(chloromethyl)-3-methylcyclohexyl]-2-(3-chlorophenyl)acetamide |
| SMILES | CC1CCCC(CCl)(NC(=O)Cc2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C16H21Cl2NO/c1-12-4-3-7-16(10-12,11-17)19-15(20)9-13-5-2-6-14(18)8-13/h2,5-6,8,12H,3-4,7,9-11H2,1H3,(H,19,20) |
| InChIKey | RAWACPKXWRRJTH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|