C13H17BrClNO2 — CID 114305731
2-bromo-N-(5-chloropentan-2-yl)-5-methoxybenzamide (PubChem CID 114305731) has the molecular formula C13H17BrClNO2 and a molecular weight of 334.64 g/mol. Its IUPAC name is 2-bromo-N-(5-chloropentan-2-yl)-5-methoxybenzamide.
| Compound Name | 2-bromo-N-(5-chloropentan-2-yl)-5-methoxybenzamide |
|---|---|
| PubChem CID | 114305731 |
| Molecular Formula | C13H17BrClNO2 |
| Molecular Weight | 334.64 g/mol |
| Exact Mass | 333.01 |
| IUPAC Name | 2-bromo-N-(5-chloropentan-2-yl)-5-methoxybenzamide |
| SMILES | COc1ccc(Br)c(C(=O)NC(C)CCCCl)c1 |
| InChI | InChI=1S/C13H17BrClNO2/c1-9(4-3-7-15)16-13(17)11-8-10(18-2)5-6-12(11)14/h5-6,8-9H,3-4,7H2,1-2H3,(H,16,17) |
| InChIKey | CYRKXBLIKKCUCH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.64 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|