C12H15BrClNO2 — CID 114295003
2-bromo-N-(1-chloro-2-methylpropan-2-yl)-5-methoxybenzamide (PubChem CID 114295003) has the molecular formula C12H15BrClNO2 and a molecular weight of 320.61 g/mol. Its IUPAC name is 2-bromo-N-(1-chloro-2-methylpropan-2-yl)-5-methoxybenzamide.
| Compound Name | 2-bromo-N-(1-chloro-2-methylpropan-2-yl)-5-methoxybenzamide |
|---|---|
| PubChem CID | 114295003 |
| Molecular Formula | C12H15BrClNO2 |
| Molecular Weight | 320.61 g/mol |
| Exact Mass | 319.00 |
| IUPAC Name | 2-bromo-N-(1-chloro-2-methylpropan-2-yl)-5-methoxybenzamide |
| SMILES | COc1ccc(Br)c(C(=O)NC(C)(C)CCl)c1 |
| InChI | InChI=1S/C12H15BrClNO2/c1-12(2,7-14)15-11(16)9-6-8(17-3)4-5-10(9)13/h4-6H,7H2,1-3H3,(H,15,16) |
| InChIKey | DHNRXKMYYMCBDY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.61 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|