C15H22ClNO4 — CID 114306196
N-(4-chloro-2-methylbutyl)-2,4,5-trimethoxybenzamide (PubChem CID 114306196) has the molecular formula C15H22ClNO4 and a molecular weight of 315.80 g/mol. Its IUPAC name is N-(4-chloro-2-methylbutyl)-2,4,5-trimethoxybenzamide.
| Compound Name | N-(4-chloro-2-methylbutyl)-2,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 114306196 |
| Molecular Formula | C15H22ClNO4 |
| Molecular Weight | 315.80 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | N-(4-chloro-2-methylbutyl)-2,4,5-trimethoxybenzamide |
| SMILES | COc1cc(OC)c(C(=O)NCC(C)CCCl)cc1OC |
| InChI | InChI=1S/C15H22ClNO4/c1-10(5-6-16)9-17-15(18)11-7-13(20-3)14(21-4)8-12(11)19-2/h7-8,10H,5-6,9H2,1-4H3,(H,17,18) |
| InChIKey | BMAIJUSHTZBFTD-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.80 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|