C8H9BrN2O2 — CID 114307487
N-(2-bromoethyl)-3-hydroxypyridine-4-carboxamide (PubChem CID 114307487) has the molecular formula C8H9BrN2O2 and a molecular weight of 245.08 g/mol. Its IUPAC name is N-(2-bromoethyl)-3-hydroxypyridine-4-carboxamide.
| Compound Name | N-(2-bromoethyl)-3-hydroxypyridine-4-carboxamide |
|---|---|
| PubChem CID | 114307487 |
| Molecular Formula | C8H9BrN2O2 |
| Molecular Weight | 245.08 g/mol |
| Exact Mass | 243.98 |
| IUPAC Name | N-(2-bromoethyl)-3-hydroxypyridine-4-carboxamide |
| SMILES | O=C(NCCBr)c1ccncc1O |
| InChI | InChI=1S/C8H9BrN2O2/c9-2-4-11-8(13)6-1-3-10-5-7(6)12/h1,3,5,12H,2,4H2,(H,11,13) |
| InChIKey | DCKDQLPEMKGPAW-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.08 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|