C10H13IN2O2 — CID 106846051
3-hydroxy-N-(4-iodobutyl)pyridine-4-carboxamide (PubChem CID 106846051) has the molecular formula C10H13IN2O2 and a molecular weight of 320.13 g/mol. Its IUPAC name is 3-hydroxy-N-(4-iodobutyl)pyridine-4-carboxamide.
| Compound Name | 3-hydroxy-N-(4-iodobutyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 106846051 |
| Molecular Formula | C10H13IN2O2 |
| Molecular Weight | 320.13 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | 3-hydroxy-N-(4-iodobutyl)pyridine-4-carboxamide |
| SMILES | O=C(NCCCCI)c1ccncc1O |
| InChI | InChI=1S/C10H13IN2O2/c11-4-1-2-5-13-10(15)8-3-6-12-7-9(8)14/h3,6-7,14H,1-2,4-5H2,(H,13,15) |
| InChIKey | ZPYLMKLPOBKERX-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.13 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|