C10H12IN3O2 — CID 174671869
3-N-(3-iodopropyl)pyridine-3,4-dicarboxamide (PubChem CID 174671869) has the molecular formula C10H12IN3O2 and a molecular weight of 333.13 g/mol. Its IUPAC name is 3-N-(3-iodopropyl)pyridine-3,4-dicarboxamide.
| Compound Name | 3-N-(3-iodopropyl)pyridine-3,4-dicarboxamide |
|---|---|
| PubChem CID | 174671869 |
| Molecular Formula | C10H12IN3O2 |
| Molecular Weight | 333.13 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | 3-N-(3-iodopropyl)pyridine-3,4-dicarboxamide |
| SMILES | NC(=O)c1ccncc1C(=O)NCCCI |
| InChI | InChI=1S/C10H12IN3O2/c11-3-1-4-14-10(16)8-6-13-5-2-7(8)9(12)15/h2,5-6H,1,3-4H2,(H2,12,15)(H,14,16) |
| InChIKey | CDMKTVYCQFLYCI-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.13 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|