C13H18BrNO — CID 114307937
N-(1-bromo-2-methylpropan-2-yl)-2-(3-methylphenyl)acetamide (PubChem CID 114307937) has the molecular formula C13H18BrNO and a molecular weight of 284.20 g/mol. Its IUPAC name is N-(1-bromo-2-methylpropan-2-yl)-2-(3-methylphenyl)acetamide.
| Compound Name | N-(1-bromo-2-methylpropan-2-yl)-2-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 114307937 |
| Molecular Formula | C13H18BrNO |
| Molecular Weight | 284.20 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | N-(1-bromo-2-methylpropan-2-yl)-2-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(CC(=O)NC(C)(C)CBr)c1 |
| InChI | InChI=1S/C13H18BrNO/c1-10-5-4-6-11(7-10)8-12(16)15-13(2,3)9-14/h4-7H,8-9H2,1-3H3,(H,15,16) |
| InChIKey | FZVCSSLCTDBGIW-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.20 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|