C13H16BrNO2 — CID 114310972
N-[4-(bromomethyl)phenyl]-5-methyloxolane-2-carboxamide (PubChem CID 114310972) has the molecular formula C13H16BrNO2 and a molecular weight of 298.18 g/mol. Its IUPAC name is N-[4-(bromomethyl)phenyl]-5-methyloxolane-2-carboxamide.
| Compound Name | N-[4-(bromomethyl)phenyl]-5-methyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 114310972 |
| Molecular Formula | C13H16BrNO2 |
| Molecular Weight | 298.18 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | N-[4-(bromomethyl)phenyl]-5-methyloxolane-2-carboxamide |
| SMILES | CC1CCC(C(=O)Nc2ccc(CBr)cc2)O1 |
| InChI | InChI=1S/C13H16BrNO2/c1-9-2-7-12(17-9)13(16)15-11-5-3-10(8-14)4-6-11/h3-6,9,12H,2,7-8H2,1H3,(H,15,16) |
| InChIKey | RHXJENNHYYXRRZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.18 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|