C13H14BrF4NO — CID 114314327
N-(1-bromo-2-methylbutan-2-yl)-2-fluoro-5-(trifluoromethyl)benzamide (PubChem CID 114314327) has the molecular formula C13H14BrF4NO and a molecular weight of 356.16 g/mol. Its IUPAC name is N-(1-bromo-2-methylbutan-2-yl)-2-fluoro-5-(trifluoromethyl)benzamide.
| Compound Name | N-(1-bromo-2-methylbutan-2-yl)-2-fluoro-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 114314327 |
| Molecular Formula | C13H14BrF4NO |
| Molecular Weight | 356.16 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | N-(1-bromo-2-methylbutan-2-yl)-2-fluoro-5-(trifluoromethyl)benzamide |
| SMILES | CCC(C)(CBr)NC(=O)c1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C13H14BrF4NO/c1-3-12(2,7-14)19-11(20)9-6-8(13(16,17)18)4-5-10(9)15/h4-6H,3,7H2,1-2H3,(H,19,20) |
| InChIKey | BNGFBYUFQONBJP-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.16 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|