C14H20BrNOS — CID 114315050
N-[1-(bromomethyl)-4-methylcyclohexyl]-2-thiophen-3-ylacetamide (PubChem CID 114315050) has the molecular formula C14H20BrNOS and a molecular weight of 330.29 g/mol. Its IUPAC name is N-[1-(bromomethyl)-4-methylcyclohexyl]-2-thiophen-3-ylacetamide.
| Compound Name | N-[1-(bromomethyl)-4-methylcyclohexyl]-2-thiophen-3-ylacetamide |
|---|---|
| PubChem CID | 114315050 |
| Molecular Formula | C14H20BrNOS |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | N-[1-(bromomethyl)-4-methylcyclohexyl]-2-thiophen-3-ylacetamide |
| SMILES | CC1CCC(CBr)(NC(=O)Cc2ccsc2)CC1 |
| InChI | InChI=1S/C14H20BrNOS/c1-11-2-5-14(10-15,6-3-11)16-13(17)8-12-4-7-18-9-12/h4,7,9,11H,2-3,5-6,8,10H2,1H3,(H,16,17) |
| InChIKey | DHLIRDROYVZKDG-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.29 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|