C15H26BrNOS — CID 83135565
N-[1-(bromomethyl)-4-methylcyclohexyl]-2-(thian-4-yl)acetamide (PubChem CID 83135565) has the molecular formula C15H26BrNOS and a molecular weight of 348.35 g/mol. Its IUPAC name is N-[1-(bromomethyl)-4-methylcyclohexyl]-2-(thian-4-yl)acetamide.
| Compound Name | N-[1-(bromomethyl)-4-methylcyclohexyl]-2-(thian-4-yl)acetamide |
|---|---|
| PubChem CID | 83135565 |
| Molecular Formula | C15H26BrNOS |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | N-[1-(bromomethyl)-4-methylcyclohexyl]-2-(thian-4-yl)acetamide |
| SMILES | CC1CCC(CBr)(NC(=O)CC2CCSCC2)CC1 |
| InChI | InChI=1S/C15H26BrNOS/c1-12-2-6-15(11-16,7-3-12)17-14(18)10-13-4-8-19-9-5-13/h12-13H,2-11H2,1H3,(H,17,18) |
| InChIKey | SMVQILWBJOHCHL-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|