C11H14BrNOS — CID 114315738
N-(2-bromo-2-cyclopropylethyl)-4-methylthiophene-3-carboxamide (PubChem CID 114315738) has the molecular formula C11H14BrNOS and a molecular weight of 288.21 g/mol. Its IUPAC name is N-(2-bromo-2-cyclopropylethyl)-4-methylthiophene-3-carboxamide.
| Compound Name | N-(2-bromo-2-cyclopropylethyl)-4-methylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 114315738 |
| Molecular Formula | C11H14BrNOS |
| Molecular Weight | 288.21 g/mol |
| Exact Mass | 287.00 |
| IUPAC Name | N-(2-bromo-2-cyclopropylethyl)-4-methylthiophene-3-carboxamide |
| SMILES | Cc1cscc1C(=O)NCC(Br)C1CC1 |
| InChI | InChI=1S/C11H14BrNOS/c1-7-5-15-6-9(7)11(14)13-4-10(12)8-2-3-8/h5-6,8,10H,2-4H2,1H3,(H,13,14) |
| InChIKey | PHLBIGALNVAVGC-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.21 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|